C20H19F3N6O2S — CID 12006235
2-[1-(2,4-dimethylphenyl)tetrazol-5-yl]sulfanyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide (PubChem CID 12006235) has the molecular formula C20H19F3N6O2S and a molecular weight of 464.47 g/mol. Its IUPAC name is 2-[1-(2,4-dimethylphenyl)tetrazol-5-yl]sulfanyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide.
| Compound Name | 2-[1-(2,4-dimethylphenyl)tetrazol-5-yl]sulfanyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide |
|---|---|
| PubChem CID | 12006235 |
| Molecular Formula | C20H19F3N6O2S |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | 2-[1-(2,4-dimethylphenyl)tetrazol-5-yl]sulfanyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide |
| SMILES | Cc1ccc(-n2nnnc2SC(C)C(=O)NCC(=O)Nc2ccc(F)c(F)c2F)c(C)c1 |
| InChI | InChI=1S/C20H19F3N6O2S/c1-10-4-7-15(11(2)8-10)29-20(26-27-28-29)32-12(3)19(31)24-9-16(30)25-14-6-5-13(21)17(22)18(14)23/h4-8,12H,9H2,1-3H3,(H,24,31)(H,25,30) |
| InChIKey | IENFTSNWYLEPMJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|