C5H10O — CID 12006902
1,1,1,3,3-pentadeuteriopentan-2-one (PubChem CID 12006902) has the molecular formula C5H10O and a molecular weight of 91.16 g/mol. Its IUPAC name is 1,1,1,3,3-pentadeuteriopentan-2-one.
| Compound Name | 1,1,1,3,3-pentadeuteriopentan-2-one |
|---|---|
| PubChem CID | 12006902 |
| Molecular Formula | C5H10O |
| Molecular Weight | 91.16 g/mol |
| Exact Mass | 91.10 |
| IUPAC Name | 1,1,1,3,3-pentadeuteriopentan-2-one |
| SMILES | [2H]C([2H])([2H])C(=O)C([2H])([2H])CC |
| InChI | InChI=1S/C5H10O/c1-3-4-5(2)6/h3-4H2,1-2H3/i2D3,4D2 |
| InChIKey | XNLICIUVMPYHGG-PVGOWFQYSA-N |
| XLogP | 1.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 91.16 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |