C24H50OSi2 — CID 12007117
tert-butyl-(3-butyl-6,6-dimethyl-4-triethylsilylcyclohex-3-en-1-yl)oxy-dimethylsilane (PubChem CID 12007117) has the molecular formula C24H50OSi2 and a molecular weight of 410.84 g/mol. Its IUPAC name is tert-butyl-(3-butyl-6,6-dimethyl-4-triethylsilylcyclohex-3-en-1-yl)oxy-dimethylsilane.
| Compound Name | tert-butyl-(3-butyl-6,6-dimethyl-4-triethylsilylcyclohex-3-en-1-yl)oxy-dimethylsilane |
|---|---|
| PubChem CID | 12007117 |
| Molecular Formula | C24H50OSi2 |
| Molecular Weight | 410.84 g/mol |
| Exact Mass | 410.34 |
| IUPAC Name | tert-butyl-(3-butyl-6,6-dimethyl-4-triethylsilylcyclohex-3-en-1-yl)oxy-dimethylsilane |
| SMILES | CCCCC1=C([Si](CC)(CC)CC)CC(C)(C)C(O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C24H50OSi2/c1-12-16-17-20-18-22(25-26(10,11)23(5,6)7)24(8,9)19-21(20)27(13-2,14-3)15-4/h22H,12-19H2,1-11H3 |
| InChIKey | OWOQTTXGVZDWRX-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.84 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|