About tert-butyl-(3-butyl-6,6-dimethyl-4-triethylsilylcyclohex-3-en-1-yl)oxy-dimethylsilane
tert-butyl-(3-butyl-6,6-dimethyl-4-triethylsilylcyclohex-3-en-1-yl)oxy-dimethylsilane (PubChem CID 12007117) has the molecular formula C24H50OSi2
and a molecular weight of 410.84 g/mol. Its IUPAC name is tert-butyl-(3-butyl-6,6-dimethyl-4-triethylsilylcyclohex-3-en-1-yl)oxy-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-(3-butyl-6,6-dimethyl-4-triethylsilylcyclohex-3-en-1-yl)oxy-dimethylsilane |
| PubChem CID | 12007117 |
| Molecular Formula | C24H50OSi2 |
| Molecular Weight | 410.84 g/mol |
| Exact Mass | 410.34 |
| IUPAC Name | tert-butyl-(3-butyl-6,6-dimethyl-4-triethylsilylcyclohex-3-en-1-yl)oxy-dimethylsilane |
| SMILES | CCCCC1=C([Si](CC)(CC)CC)CC(C)(C)C(O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C24H50OSi2/c1-12-16-17-20-18-22(25-26(10,11)23(5,6)7)24(8,9)19-21(20)27(13-2,14-3)15-4/h22H,12-19H2,1-11H3 |
| InChIKey | OWOQTTXGVZDWRX-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.84 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-(3-butyl-6,6-dimethyl-4-triethylsilylcyclohex-3-en-1-yl)oxy-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-(3-butyl-6,6-dimethyl-4-triethylsilylcyclohex-3-en-1-yl)oxy-dimethylsilane?
The IUPAC name of tert-butyl-(3-butyl-6,6-dimethyl-4-triethylsilylcyclohex-3-en-1-yl)oxy-dimethylsilane (CID 12007117) is tert-butyl-(3-butyl-6,6-dimethyl-4-triethylsilylcyclohex-3-en-1-yl)oxy-dimethylsilane.
What is the SMILES notation for tert-butyl-(3-butyl-6,6-dimethyl-4-triethylsilylcyclohex-3-en-1-yl)oxy-dimethylsilane?
The canonical SMILES for tert-butyl-(3-butyl-6,6-dimethyl-4-triethylsilylcyclohex-3-en-1-yl)oxy-dimethylsilane is CCCCC1=C([Si](CC)(CC)CC)CC(C)(C)C(O[Si](C)(C)C(C)(C)C)C1.
What is the InChIKey of tert-butyl-(3-butyl-6,6-dimethyl-4-triethylsilylcyclohex-3-en-1-yl)oxy-dimethylsilane?
The InChIKey is OWOQTTXGVZDWRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H50OSi2/c1-12-16-17-20-18-22(25-26(10,11)23(5,6)7)24(8,9)19-21(20)27(13-2,14-3)15-4/h22H,12-19H2,1-11H3.
What are the key properties of tert-butyl-(3-butyl-6,6-dimethyl-4-triethylsilylcyclohex-3-en-1-yl)oxy-dimethylsilane?
tert-butyl-(3-butyl-6,6-dimethyl-4-triethylsilylcyclohex-3-en-1-yl)oxy-dimethylsilane has a molecular weight of 410.84 g/mol, XLogP of 8.73, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-(3-butyl-6,6-dimethyl-4-triethylsilylcyclohex-3-en-1-yl)oxy-dimethylsilane is sourced from PubChem (CID 12007117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).