C21H36ClN5O2 — CID 12007181
2-chloro-4,6-bis[(2,2,6,6-tetramethylpiperidin-4-yl)oxy]-1,3,5-triazine (PubChem CID 12007181) has the molecular formula C21H36ClN5O2 and a molecular weight of 426.01 g/mol. Its IUPAC name is 2-chloro-4,6-bis[(2,2,6,6-tetramethylpiperidin-4-yl)oxy]-1,3,5-triazine.
| Compound Name | 2-chloro-4,6-bis[(2,2,6,6-tetramethylpiperidin-4-yl)oxy]-1,3,5-triazine |
|---|---|
| PubChem CID | 12007181 |
| Molecular Formula | C21H36ClN5O2 |
| Molecular Weight | 426.01 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | 2-chloro-4,6-bis[(2,2,6,6-tetramethylpiperidin-4-yl)oxy]-1,3,5-triazine |
| SMILES | CC1(C)CC(Oc2nc(Cl)nc(OC3CC(C)(C)NC(C)(C)C3)n2)CC(C)(C)N1 |
| InChI | InChI=1S/C21H36ClN5O2/c1-18(2)9-13(10-19(3,4)26-18)28-16-23-15(22)24-17(25-16)29-14-11-20(5,6)27-21(7,8)12-14/h13-14,26-27H,9-12H2,1-8H3 |
| InChIKey | VBSHCAIKYLBPCY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.01 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |