About 2-azido-1,3-bis(bromomethyl)benzene
2-azido-1,3-bis(bromomethyl)benzene (PubChem CID 12007208) has the molecular formula C8H7Br2N3
and a molecular weight of 304.97 g/mol. Its IUPAC name is 2-azido-1,3-bis(bromomethyl)benzene.
Molecular Properties
| Compound Name | 2-azido-1,3-bis(bromomethyl)benzene |
| PubChem CID | 12007208 |
| Molecular Formula | C8H7Br2N3 |
| Molecular Weight | 304.97 g/mol |
| Exact Mass | 302.90 |
| IUPAC Name | 2-azido-1,3-bis(bromomethyl)benzene |
| SMILES | [N-]=[N+]=Nc1c(CBr)cccc1CBr |
| InChI | InChI=1S/C8H7Br2N3/c9-4-6-2-1-3-7(5-10)8(6)12-13-11/h1-3H,4-5H2 |
| InChIKey | JQAOTQGKFCEVSM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.97 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-azido-1,3-bis(bromomethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azido-1,3-bis(bromomethyl)benzene?
The IUPAC name of 2-azido-1,3-bis(bromomethyl)benzene (CID 12007208) is 2-azido-1,3-bis(bromomethyl)benzene.
What is the SMILES notation for 2-azido-1,3-bis(bromomethyl)benzene?
The canonical SMILES for 2-azido-1,3-bis(bromomethyl)benzene is [N-]=[N+]=Nc1c(CBr)cccc1CBr.
What is the InChIKey of 2-azido-1,3-bis(bromomethyl)benzene?
The InChIKey is JQAOTQGKFCEVSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Br2N3/c9-4-6-2-1-3-7(5-10)8(6)12-13-11/h1-3H,4-5H2.
What are the key properties of 2-azido-1,3-bis(bromomethyl)benzene?
2-azido-1,3-bis(bromomethyl)benzene has a molecular weight of 304.97 g/mol, XLogP of 4.42, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azido-1,3-bis(bromomethyl)benzene is sourced from PubChem (CID 12007208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).