About 1-(4-chlorophenyl)sulfanyl-1,1-difluoro-3,3-dimethylbutan-2-one
1-(4-chlorophenyl)sulfanyl-1,1-difluoro-3,3-dimethylbutan-2-one (PubChem CID 12007561) has the molecular formula C12H13ClF2OS
and a molecular weight of 278.75 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfanyl-1,1-difluoro-3,3-dimethylbutan-2-one.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)sulfanyl-1,1-difluoro-3,3-dimethylbutan-2-one |
| PubChem CID | 12007561 |
| Molecular Formula | C12H13ClF2OS |
| Molecular Weight | 278.75 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 1-(4-chlorophenyl)sulfanyl-1,1-difluoro-3,3-dimethylbutan-2-one |
| SMILES | CC(C)(C)C(=O)C(F)(F)Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H13ClF2OS/c1-11(2,3)10(16)12(14,15)17-9-6-4-8(13)5-7-9/h4-7H,1-3H3 |
| InChIKey | YSBDTOQYUKUNRK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.75 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-chlorophenyl)sulfanyl-1,1-difluoro-3,3-dimethylbutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)sulfanyl-1,1-difluoro-3,3-dimethylbutan-2-one?
The IUPAC name of 1-(4-chlorophenyl)sulfanyl-1,1-difluoro-3,3-dimethylbutan-2-one (CID 12007561) is 1-(4-chlorophenyl)sulfanyl-1,1-difluoro-3,3-dimethylbutan-2-one.
What is the SMILES notation for 1-(4-chlorophenyl)sulfanyl-1,1-difluoro-3,3-dimethylbutan-2-one?
The canonical SMILES for 1-(4-chlorophenyl)sulfanyl-1,1-difluoro-3,3-dimethylbutan-2-one is CC(C)(C)C(=O)C(F)(F)Sc1ccc(Cl)cc1.
What is the InChIKey of 1-(4-chlorophenyl)sulfanyl-1,1-difluoro-3,3-dimethylbutan-2-one?
The InChIKey is YSBDTOQYUKUNRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClF2OS/c1-11(2,3)10(16)12(14,15)17-9-6-4-8(13)5-7-9/h4-7H,1-3H3.
What are the key properties of 1-(4-chlorophenyl)sulfanyl-1,1-difluoro-3,3-dimethylbutan-2-one?
1-(4-chlorophenyl)sulfanyl-1,1-difluoro-3,3-dimethylbutan-2-one has a molecular weight of 278.75 g/mol, XLogP of 4.64, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)sulfanyl-1,1-difluoro-3,3-dimethylbutan-2-one is sourced from PubChem (CID 12007561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).