C24H25NO5 — CID 12007575
methyl (4S)-5-[(4R)-4-benzhydryl-2-oxo-1,3-oxazolidin-3-yl]-4-methyl-2-methylidene-5-oxopentanoate (PubChem CID 12007575) has the molecular formula C24H25NO5 and a molecular weight of 407.47 g/mol. Its IUPAC name is methyl (4S)-5-[(4R)-4-benzhydryl-2-oxo-1,3-oxazolidin-3-yl]-4-methyl-2-methylidene-5-oxopentanoate.
| Compound Name | methyl (4S)-5-[(4R)-4-benzhydryl-2-oxo-1,3-oxazolidin-3-yl]-4-methyl-2-methylidene-5-oxopentanoate |
|---|---|
| PubChem CID | 12007575 |
| Molecular Formula | C24H25NO5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | methyl (4S)-5-[(4R)-4-benzhydryl-2-oxo-1,3-oxazolidin-3-yl]-4-methyl-2-methylidene-5-oxopentanoate |
| SMILES | C=C(C[C@H](C)C(=O)N1C(=O)OC[C@H]1C(c1ccccc1)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C24H25NO5/c1-16(14-17(2)23(27)29-3)22(26)25-20(15-30-24(25)28)21(18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-13,16,20-21H,2,14-15H2,1,3H3/t16-,20-/m0/s1 |
| InChIKey | UAQZSTILJVTVAI-JXFKEZNVSA-N |
| XLogP | 3.92 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|