C14H20O2S — CID 12008239
(1S)-1-[(2S,4S)-5,5-dimethyl-4-phenylsulfanyloxolan-2-yl]ethanol (PubChem CID 12008239) has the molecular formula C14H20O2S and a molecular weight of 252.38 g/mol. Its IUPAC name is (1S)-1-[(2S,4S)-5,5-dimethyl-4-phenylsulfanyloxolan-2-yl]ethanol.
| Compound Name | (1S)-1-[(2S,4S)-5,5-dimethyl-4-phenylsulfanyloxolan-2-yl]ethanol |
|---|---|
| PubChem CID | 12008239 |
| Molecular Formula | C14H20O2S |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | (1S)-1-[(2S,4S)-5,5-dimethyl-4-phenylsulfanyloxolan-2-yl]ethanol |
| SMILES | C[C@H](O)[C@@H]1C[C@H](Sc2ccccc2)C(C)(C)O1 |
| InChI | InChI=1S/C14H20O2S/c1-10(15)12-9-13(14(2,3)16-12)17-11-7-5-4-6-8-11/h4-8,10,12-13,15H,9H2,1-3H3/t10-,12-,13-/m0/s1 |
| InChIKey | UCNJQBLTKUMTOJ-DRZSPHRISA-N |
| XLogP | 3.10 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |