C12H11F3N2 — CID 12008483
1,3-dimethyl-4-phenyl-5-(trifluoromethyl)pyrazole (PubChem CID 12008483) has the molecular formula C12H11F3N2 and a molecular weight of 240.23 g/mol. Its IUPAC name is 1,3-dimethyl-4-phenyl-5-(trifluoromethyl)pyrazole.
| Compound Name | 1,3-dimethyl-4-phenyl-5-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 12008483 |
| Molecular Formula | C12H11F3N2 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 1,3-dimethyl-4-phenyl-5-(trifluoromethyl)pyrazole |
| SMILES | Cc1nn(C)c(C(F)(F)F)c1-c1ccccc1 |
| InChI | InChI=1S/C12H11F3N2/c1-8-10(9-6-4-3-5-7-9)11(12(13,14)15)17(2)16-8/h3-7H,1-2H3 |
| InChIKey | PSUNIQGPGGGYIP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |