C16H10F10N2O2 — CID 12008503
2-(2,2,3,3,3-pentafluoropropoxy)-6-[6-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl]pyridine (PubChem CID 12008503) has the molecular formula C16H10F10N2O2 and a molecular weight of 452.25 g/mol. Its IUPAC name is 2-(2,2,3,3,3-pentafluoropropoxy)-6-[6-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl]pyridine.
| Compound Name | 2-(2,2,3,3,3-pentafluoropropoxy)-6-[6-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl]pyridine |
|---|---|
| PubChem CID | 12008503 |
| Molecular Formula | C16H10F10N2O2 |
| Molecular Weight | 452.25 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 2-(2,2,3,3,3-pentafluoropropoxy)-6-[6-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl]pyridine |
| SMILES | FC(F)(F)C(F)(F)COc1cccc(-c2cccc(OCC(F)(F)C(F)(F)F)n2)n1 |
| InChI | InChI=1S/C16H10F10N2O2/c17-13(18,15(21,22)23)7-29-11-5-1-3-9(27-11)10-4-2-6-12(28-10)30-8-14(19,20)16(24,25)26/h1-6H,7-8H2 |
| InChIKey | OMXSGVRZEGWJAT-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.25 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|