C12H16F3NO — CID 12008692
1,1,1-trifluoro-5-phenylmethoxypentan-2-amine (PubChem CID 12008692) has the molecular formula C12H16F3NO and a molecular weight of 247.26 g/mol. Its IUPAC name is 1,1,1-trifluoro-5-phenylmethoxypentan-2-amine.
| Compound Name | 1,1,1-trifluoro-5-phenylmethoxypentan-2-amine |
|---|---|
| PubChem CID | 12008692 |
| Molecular Formula | C12H16F3NO |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 1,1,1-trifluoro-5-phenylmethoxypentan-2-amine |
| SMILES | NC(CCCOCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H16F3NO/c13-12(14,15)11(16)7-4-8-17-9-10-5-2-1-3-6-10/h1-3,5-6,11H,4,7-9,16H2 |
| InChIKey | SUFVERIIFWEASB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|