C9H11NS — CID 12009047
6-thiophen-2-yl-2,3,4,5-tetrahydropyridine (PubChem CID 12009047) has the molecular formula C9H11NS and a molecular weight of 165.26 g/mol. Its IUPAC name is 6-thiophen-2-yl-2,3,4,5-tetrahydropyridine.
| Compound Name | 6-thiophen-2-yl-2,3,4,5-tetrahydropyridine |
|---|---|
| PubChem CID | 12009047 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 6-thiophen-2-yl-2,3,4,5-tetrahydropyridine |
| SMILES | c1csc(C2=NCCCC2)c1 |
| InChI | InChI=1S/C9H11NS/c1-2-6-10-8(4-1)9-5-3-7-11-9/h3,5,7H,1-2,4,6H2 |
| InChIKey | VRLQLBABYKISJC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |