About 2-propoxy-2,3-dihydro-1H-indene
2-propoxy-2,3-dihydro-1H-indene (PubChem CID 12009073) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is 2-propoxy-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | 2-propoxy-2,3-dihydro-1H-indene |
| PubChem CID | 12009073 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 2-propoxy-2,3-dihydro-1H-indene |
| SMILES | CCCOC1Cc2ccccc2C1 |
| InChI | InChI=1S/C12H16O/c1-2-7-13-12-8-10-5-3-4-6-11(10)9-12/h3-6,12H,2,7-9H2,1H3 |
| InChIKey | FRQHJNVQDCQNCF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-propoxy-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propoxy-2,3-dihydro-1H-indene?
The IUPAC name of 2-propoxy-2,3-dihydro-1H-indene (CID 12009073) is 2-propoxy-2,3-dihydro-1H-indene.
What is the SMILES notation for 2-propoxy-2,3-dihydro-1H-indene?
The canonical SMILES for 2-propoxy-2,3-dihydro-1H-indene is CCCOC1Cc2ccccc2C1.
What is the InChIKey of 2-propoxy-2,3-dihydro-1H-indene?
The InChIKey is FRQHJNVQDCQNCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O/c1-2-7-13-12-8-10-5-3-4-6-11(10)9-12/h3-6,12H,2,7-9H2,1H3.
What are the key properties of 2-propoxy-2,3-dihydro-1H-indene?
2-propoxy-2,3-dihydro-1H-indene has a molecular weight of 176.26 g/mol, XLogP of 2.58, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propoxy-2,3-dihydro-1H-indene is sourced from PubChem (CID 12009073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).