About (2R)-2,4-dihydroxybutanamide
(2R)-2,4-dihydroxybutanamide (PubChem CID 12009649) has the molecular formula C4H9NO3
and a molecular weight of 119.12 g/mol. Its IUPAC name is (2R)-2,4-dihydroxybutanamide.
Molecular Properties
| Compound Name | (2R)-2,4-dihydroxybutanamide |
| PubChem CID | 12009649 |
| Molecular Formula | C4H9NO3 |
| Molecular Weight | 119.12 g/mol |
| Exact Mass | 119.06 |
| IUPAC Name | (2R)-2,4-dihydroxybutanamide |
| SMILES | NC(=O)[C@H](O)CCO |
| InChI | InChI=1S/C4H9NO3/c5-4(8)3(7)1-2-6/h3,6-7H,1-2H2,(H2,5,8)/t3-/m1/s1 |
| InChIKey | FVLOHZJVLFKDNU-GSVOUGTGSA-N |
| XLogP | -1.78 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.12 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2,4-dihydroxybutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2,4-dihydroxybutanamide?
The IUPAC name of (2R)-2,4-dihydroxybutanamide (CID 12009649) is (2R)-2,4-dihydroxybutanamide.
What is the SMILES notation for (2R)-2,4-dihydroxybutanamide?
The canonical SMILES for (2R)-2,4-dihydroxybutanamide is NC(=O)[C@H](O)CCO.
What is the InChIKey of (2R)-2,4-dihydroxybutanamide?
The InChIKey is FVLOHZJVLFKDNU-GSVOUGTGSA-N. The full InChI is InChI=1S/C4H9NO3/c5-4(8)3(7)1-2-6/h3,6-7H,1-2H2,(H2,5,8)/t3-/m1/s1.
What are the key properties of (2R)-2,4-dihydroxybutanamide?
(2R)-2,4-dihydroxybutanamide has a molecular weight of 119.12 g/mol, XLogP of -1.78, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2,4-dihydroxybutanamide is sourced from PubChem (CID 12009649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).