C24H17F6NO — CID 12009790
(2R)-5-(2,6-difluorophenyl)-2-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]-3,4-dihydro-2H-pyrrole (PubChem CID 12009790) has the molecular formula C24H17F6NO and a molecular weight of 449.39 g/mol. Its IUPAC name is (2R)-5-(2,6-difluorophenyl)-2-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]-3,4-dihydro-2H-pyrrole.
| Compound Name | (2R)-5-(2,6-difluorophenyl)-2-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 12009790 |
| Molecular Formula | C24H17F6NO |
| Molecular Weight | 449.39 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | (2R)-5-(2,6-difluorophenyl)-2-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]-3,4-dihydro-2H-pyrrole |
| SMILES | Fc1cccc(F)c1C1=N[C@@H](c2ccc(-c3ccc(OC(F)(F)C(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C24H17F6NO/c25-18-2-1-3-19(26)22(18)21-13-12-20(31-21)16-6-4-14(5-7-16)15-8-10-17(11-9-15)32-24(29,30)23(27)28/h1-11,20,23H,12-13H2/t20-/m1/s1 |
| InChIKey | CQANMUAVCRWZGN-HXUWFJFHSA-N |
| XLogP | 7.19 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.39 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|