C19H20Cl2N2O4 — CID 12009885
2-[2,4-dichloro-3-[(3-methyl-2-oxo-1,3-diazinan-1-yl)methyl]benzoyl]cyclohexane-1,3-dione (PubChem CID 12009885) has the molecular formula C19H20Cl2N2O4 and a molecular weight of 411.29 g/mol. Its IUPAC name is 2-[2,4-dichloro-3-[(3-methyl-2-oxo-1,3-diazinan-1-yl)methyl]benzoyl]cyclohexane-1,3-dione.
| Compound Name | 2-[2,4-dichloro-3-[(3-methyl-2-oxo-1,3-diazinan-1-yl)methyl]benzoyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 12009885 |
| Molecular Formula | C19H20Cl2N2O4 |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 2-[2,4-dichloro-3-[(3-methyl-2-oxo-1,3-diazinan-1-yl)methyl]benzoyl]cyclohexane-1,3-dione |
| SMILES | CN1CCCN(Cc2c(Cl)ccc(C(=O)C3C(=O)CCCC3=O)c2Cl)C1=O |
| InChI | InChI=1S/C19H20Cl2N2O4/c1-22-8-3-9-23(19(22)27)10-12-13(20)7-6-11(17(12)21)18(26)16-14(24)4-2-5-15(16)25/h6-7,16H,2-5,8-10H2,1H3 |
| InChIKey | XCZFSFNMYRDTAD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|