C9H10F8O2 — CID 12010403
3-methyl-3-(1,1,2,3,3,4,4,4-octafluorobutoxymethyl)oxetane (PubChem CID 12010403) has the molecular formula C9H10F8O2 and a molecular weight of 302.16 g/mol. Its IUPAC name is 3-methyl-3-(1,1,2,3,3,4,4,4-octafluorobutoxymethyl)oxetane.
| Compound Name | 3-methyl-3-(1,1,2,3,3,4,4,4-octafluorobutoxymethyl)oxetane |
|---|---|
| PubChem CID | 12010403 |
| Molecular Formula | C9H10F8O2 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 3-methyl-3-(1,1,2,3,3,4,4,4-octafluorobutoxymethyl)oxetane |
| SMILES | CC1(COC(F)(F)C(F)C(F)(F)C(F)(F)F)COC1 |
| InChI | InChI=1S/C9H10F8O2/c1-6(2-18-3-6)4-19-8(13,14)5(10)7(11,12)9(15,16)17/h5H,2-4H2,1H3 |
| InChIKey | ZJYXFFHYHRZJCY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|