About bis(2-[3,5-bis(trifluoromethyl)phenyl]-1H-inden-1-ide);dichlorozirconium(2+)
bis(2-[3,5-bis(trifluoromethyl)phenyl]-1H-inden-1-ide);dichlorozirconium(2+) (PubChem CID 12010624) has the molecular formula C34H18Cl2F12Zr
and a molecular weight of 816.62 g/mol. Its IUPAC name is bis(2-[3,5-bis(trifluoromethyl)phenyl]-1H-inden-1-ide);dichlorozirconium(2+).
Molecular Properties
| Compound Name | bis(2-[3,5-bis(trifluoromethyl)phenyl]-1H-inden-1-ide);dichlorozirconium(2+) |
| PubChem CID | 12010624 |
| Molecular Formula | C34H18Cl2F12Zr |
| Molecular Weight | 816.62 g/mol |
| Exact Mass | 813.96 |
| IUPAC Name | bis(2-[3,5-bis(trifluoromethyl)phenyl]-1H-inden-1-ide);dichlorozirconium(2+) |
| SMILES | Cl[Zr+2]Cl.FC(F)(F)c1cc(-c2cc3ccccc3[cH-]2)cc(C(F)(F)F)c1.FC(F)(F)c1cc(-c2cc3ccccc3[cH-]2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/2C17H9F6.2ClH.Zr/c2*18-16(19,20)14-7-13(8-15(9-14)17(21,22)23)12-5-10-3-1-2-4-11(10)6-12;;;/h2*1-9H;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | AJIZPBUPVDYYJU-UHFFFAOYSA-L |
| XLogP | 13.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 816.62 |
| LogP ≤ 5 | 13.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze bis(2-[3,5-bis(trifluoromethyl)phenyl]-1H-inden-1-ide);dichlorozirconium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-[3,5-bis(trifluoromethyl)phenyl]-1H-inden-1-ide);dichlorozirconium(2+)?
The IUPAC name of bis(2-[3,5-bis(trifluoromethyl)phenyl]-1H-inden-1-ide);dichlorozirconium(2+) (CID 12010624) is bis(2-[3,5-bis(trifluoromethyl)phenyl]-1H-inden-1-ide);dichlorozirconium(2+).
What is the SMILES notation for bis(2-[3,5-bis(trifluoromethyl)phenyl]-1H-inden-1-ide);dichlorozirconium(2+)?
The canonical SMILES for bis(2-[3,5-bis(trifluoromethyl)phenyl]-1H-inden-1-ide);dichlorozirconium(2+) is Cl[Zr+2]Cl.FC(F)(F)c1cc(-c2cc3ccccc3[cH-]2)cc(C(F)(F)F)c1.FC(F)(F)c1cc(-c2cc3ccccc3[cH-]2)cc(C(F)(F)F)c1.
What is the InChIKey of bis(2-[3,5-bis(trifluoromethyl)phenyl]-1H-inden-1-ide);dichlorozirconium(2+)?
The InChIKey is AJIZPBUPVDYYJU-UHFFFAOYSA-L. The full InChI is InChI=1S/2C17H9F6.2ClH.Zr/c2*18-16(19,20)14-7-13(8-15(9-14)17(21,22)23)12-5-10-3-1-2-4-11(10)6-12;;;/h2*1-9H;2*1H;/q2*-1;;;+4/p-2.
What are the key properties of bis(2-[3,5-bis(trifluoromethyl)phenyl]-1H-inden-1-ide);dichlorozirconium(2+)?
bis(2-[3,5-bis(trifluoromethyl)phenyl]-1H-inden-1-ide);dichlorozirconium(2+) has a molecular weight of 816.62 g/mol, XLogP of 13.90, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-[3,5-bis(trifluoromethyl)phenyl]-1H-inden-1-ide);dichlorozirconium(2+) is sourced from PubChem (CID 12010624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).