C35H36F3N3O — CID 12010655
2-(1,1-diphenylethyl)-6-[5-(trifluoromethyl)benzotriazol-2-yl]-4-(2,4,4-trimethylpentan-2-yl)phenol (PubChem CID 12010655) has the molecular formula C35H36F3N3O and a molecular weight of 571.69 g/mol. Its IUPAC name is 2-(1,1-diphenylethyl)-6-[5-(trifluoromethyl)benzotriazol-2-yl]-4-(2,4,4-trimethylpentan-2-yl)phenol.
| Compound Name | 2-(1,1-diphenylethyl)-6-[5-(trifluoromethyl)benzotriazol-2-yl]-4-(2,4,4-trimethylpentan-2-yl)phenol |
|---|---|
| PubChem CID | 12010655 |
| Molecular Formula | C35H36F3N3O |
| Molecular Weight | 571.69 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | 2-(1,1-diphenylethyl)-6-[5-(trifluoromethyl)benzotriazol-2-yl]-4-(2,4,4-trimethylpentan-2-yl)phenol |
| SMILES | CC(C)(C)CC(C)(C)c1cc(-n2nc3ccc(C(F)(F)F)cc3n2)c(O)c(C(C)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C35H36F3N3O/c1-32(2,3)22-33(4,5)26-19-27(34(6,23-13-9-7-10-14-23)24-15-11-8-12-16-24)31(42)30(21-26)41-39-28-18-17-25(35(36,37)38)20-29(28)40-41/h7-21,42H,22H2,1-6H3 |
| InChIKey | FWKSEVVMZUFHAT-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.69 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|