C8H16N6O — CID 12010694
5-[(4,6-diamino-1,3,5-triazin-2-yl)amino]pentan-1-ol (PubChem CID 12010694) has the molecular formula C8H16N6O and a molecular weight of 212.26 g/mol. Its IUPAC name is 5-[(4,6-diamino-1,3,5-triazin-2-yl)amino]pentan-1-ol.
| Compound Name | 5-[(4,6-diamino-1,3,5-triazin-2-yl)amino]pentan-1-ol |
|---|---|
| PubChem CID | 12010694 |
| Molecular Formula | C8H16N6O |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 5-[(4,6-diamino-1,3,5-triazin-2-yl)amino]pentan-1-ol |
| SMILES | Nc1nc(N)nc(NCCCCCO)n1 |
| InChI | InChI=1S/C8H16N6O/c9-6-12-7(10)14-8(13-6)11-4-2-1-3-5-15/h15H,1-5H2,(H5,9,10,11,12,13,14) |
| InChIKey | KKKLGUUDKIHGIE-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 122.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|