C12H19N3O3 — CID 12010773
5-(2,4-dimethylpyrrolidin-3-yl)-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 12010773) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 5-(2,4-dimethylpyrrolidin-3-yl)-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(2,4-dimethylpyrrolidin-3-yl)-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 12010773 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 5-(2,4-dimethylpyrrolidin-3-yl)-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CC1CNC(C)C1C1C(=O)N(C)C(=O)N(C)C1=O |
| InChI | InChI=1S/C12H19N3O3/c1-6-5-13-7(2)8(6)9-10(16)14(3)12(18)15(4)11(9)17/h6-9,13H,5H2,1-4H3 |
| InChIKey | WMALOYCCLLKXBP-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|