C13H21N3O3 — CID 12010777
1,3-dimethyl-5-(2-propan-2-ylpyrrolidin-3-yl)-1,3-diazinane-2,4,6-trione (PubChem CID 12010777) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 1,3-dimethyl-5-(2-propan-2-ylpyrrolidin-3-yl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-dimethyl-5-(2-propan-2-ylpyrrolidin-3-yl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 12010777 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 1,3-dimethyl-5-(2-propan-2-ylpyrrolidin-3-yl)-1,3-diazinane-2,4,6-trione |
| SMILES | CC(C)C1NCCC1C1C(=O)N(C)C(=O)N(C)C1=O |
| InChI | InChI=1S/C13H21N3O3/c1-7(2)10-8(5-6-14-10)9-11(17)15(3)13(19)16(4)12(9)18/h7-10,14H,5-6H2,1-4H3 |
| InChIKey | MFLQHFLGLBPAFG-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|