C20H25NO3 — CID 12010813
(2E)-2-(5,6-dimethoxy-3,3-dimethyl-2H-inden-1-ylidene)-4,4-dimethyl-3-oxopentanenitrile (PubChem CID 12010813) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is (2E)-2-(5,6-dimethoxy-3,3-dimethyl-2H-inden-1-ylidene)-4,4-dimethyl-3-oxopentanenitrile.
| Compound Name | (2E)-2-(5,6-dimethoxy-3,3-dimethyl-2H-inden-1-ylidene)-4,4-dimethyl-3-oxopentanenitrile |
|---|---|
| PubChem CID | 12010813 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | (2E)-2-(5,6-dimethoxy-3,3-dimethyl-2H-inden-1-ylidene)-4,4-dimethyl-3-oxopentanenitrile |
| SMILES | COc1cc2c(cc1OC)C(C)(C)C/C2=C(/C#N)C(=O)C(C)(C)C |
| InChI | InChI=1S/C20H25NO3/c1-19(2,3)18(22)14(11-21)13-10-20(4,5)15-9-17(24-7)16(23-6)8-12(13)15/h8-9H,10H2,1-7H3/b14-13+ |
| InChIKey | LLUQHMKOHWBDHG-BUHFOSPRSA-N |
| XLogP | 4.28 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|