About (Z)-2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(4-fluorophenyl)-N-methoxyethanimine
(Z)-2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(4-fluorophenyl)-N-methoxyethanimine (PubChem CID 12011161) has the molecular formula C18H14F7NO2
and a molecular weight of 409.30 g/mol. Its IUPAC name is (Z)-2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(4-fluorophenyl)-N-methoxyethanimine.
Molecular Properties
| Compound Name | (Z)-2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(4-fluorophenyl)-N-methoxyethanimine |
| PubChem CID | 12011161 |
| Molecular Formula | C18H14F7NO2 |
| Molecular Weight | 409.30 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | (Z)-2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(4-fluorophenyl)-N-methoxyethanimine |
| SMILES | CO/N=C(\COCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H14F7NO2/c1-27-26-16(12-2-4-15(19)5-3-12)10-28-9-11-6-13(17(20,21)22)8-14(7-11)18(23,24)25/h2-8H,9-10H2,1H3/b26-16+ |
| InChIKey | FMRWYKKXPMEIHO-WGOQTCKBSA-N |
| XLogP | 5.43 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.30 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(4-fluorophenyl)-N-methoxyethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(4-fluorophenyl)-N-methoxyethanimine?
The IUPAC name of (Z)-2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(4-fluorophenyl)-N-methoxyethanimine (CID 12011161) is (Z)-2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(4-fluorophenyl)-N-methoxyethanimine.
What is the SMILES notation for (Z)-2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(4-fluorophenyl)-N-methoxyethanimine?
The canonical SMILES for (Z)-2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(4-fluorophenyl)-N-methoxyethanimine is CO/N=C(\COCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccc(F)cc1.
What is the InChIKey of (Z)-2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(4-fluorophenyl)-N-methoxyethanimine?
The InChIKey is FMRWYKKXPMEIHO-WGOQTCKBSA-N. The full InChI is InChI=1S/C18H14F7NO2/c1-27-26-16(12-2-4-15(19)5-3-12)10-28-9-11-6-13(17(20,21)22)8-14(7-11)18(23,24)25/h2-8H,9-10H2,1H3/b26-16+.
What are the key properties of (Z)-2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(4-fluorophenyl)-N-methoxyethanimine?
(Z)-2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(4-fluorophenyl)-N-methoxyethanimine has a molecular weight of 409.30 g/mol, XLogP of 5.43, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(4-fluorophenyl)-N-methoxyethanimine is sourced from PubChem (CID 12011161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).