About 2-(1,3-thiazol-2-yl)benzene-1,4-diamine
2-(1,3-thiazol-2-yl)benzene-1,4-diamine (PubChem CID 12011831) has the molecular formula C9H9N3S
and a molecular weight of 191.26 g/mol. Its IUPAC name is 2-(1,3-thiazol-2-yl)benzene-1,4-diamine.
Molecular Properties
| Compound Name | 2-(1,3-thiazol-2-yl)benzene-1,4-diamine |
| PubChem CID | 12011831 |
| Molecular Formula | C9H9N3S |
| Molecular Weight | 191.26 g/mol |
| Exact Mass | 191.05 |
| IUPAC Name | 2-(1,3-thiazol-2-yl)benzene-1,4-diamine |
| SMILES | Nc1ccc(N)c(-c2nccs2)c1 |
| InChI | InChI=1S/C9H9N3S/c10-6-1-2-8(11)7(5-6)9-12-3-4-13-9/h1-5H,10-11H2 |
| InChIKey | NDSQCPUOJHJUJB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-thiazol-2-yl)benzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-thiazol-2-yl)benzene-1,4-diamine?
The IUPAC name of 2-(1,3-thiazol-2-yl)benzene-1,4-diamine (CID 12011831) is 2-(1,3-thiazol-2-yl)benzene-1,4-diamine.
What is the SMILES notation for 2-(1,3-thiazol-2-yl)benzene-1,4-diamine?
The canonical SMILES for 2-(1,3-thiazol-2-yl)benzene-1,4-diamine is Nc1ccc(N)c(-c2nccs2)c1.
What is the InChIKey of 2-(1,3-thiazol-2-yl)benzene-1,4-diamine?
The InChIKey is NDSQCPUOJHJUJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3S/c10-6-1-2-8(11)7(5-6)9-12-3-4-13-9/h1-5H,10-11H2.
What are the key properties of 2-(1,3-thiazol-2-yl)benzene-1,4-diamine?
2-(1,3-thiazol-2-yl)benzene-1,4-diamine has a molecular weight of 191.26 g/mol, XLogP of 1.97, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-thiazol-2-yl)benzene-1,4-diamine is sourced from PubChem (CID 12011831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).