C16H26O3 — CID 12012143
ethyl (1S,3aR,7aR)-3a,7,7,7a-tetramethyl-2-oxo-3,4,5,6-tetrahydro-1H-indene-1-carboxylate (PubChem CID 12012143) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is ethyl (1S,3aR,7aR)-3a,7,7,7a-tetramethyl-2-oxo-3,4,5,6-tetrahydro-1H-indene-1-carboxylate.
| Compound Name | ethyl (1S,3aR,7aR)-3a,7,7,7a-tetramethyl-2-oxo-3,4,5,6-tetrahydro-1H-indene-1-carboxylate |
|---|---|
| PubChem CID | 12012143 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | ethyl (1S,3aR,7aR)-3a,7,7,7a-tetramethyl-2-oxo-3,4,5,6-tetrahydro-1H-indene-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)C[C@@]2(C)CCCC(C)(C)[C@@]12C |
| InChI | InChI=1S/C16H26O3/c1-6-19-13(18)12-11(17)10-15(4)9-7-8-14(2,3)16(12,15)5/h12H,6-10H2,1-5H3/t12-,15+,16+/m0/s1 |
| InChIKey | XJNNRDIRAAFDSH-APHBMKBZSA-N |
| XLogP | 3.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|