C15H24O2 — CID 12012146
(3aR,4aR,8aR,8bR)-4a,8,8,8a-tetramethyl-3a,4,5,6,7,8b-hexahydro-3H-indeno[1,2-c]furan-1-one (PubChem CID 12012146) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (3aR,4aR,8aR,8bR)-4a,8,8,8a-tetramethyl-3a,4,5,6,7,8b-hexahydro-3H-indeno[1,2-c]furan-1-one.
| Compound Name | (3aR,4aR,8aR,8bR)-4a,8,8,8a-tetramethyl-3a,4,5,6,7,8b-hexahydro-3H-indeno[1,2-c]furan-1-one |
|---|---|
| PubChem CID | 12012146 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (3aR,4aR,8aR,8bR)-4a,8,8,8a-tetramethyl-3a,4,5,6,7,8b-hexahydro-3H-indeno[1,2-c]furan-1-one |
| SMILES | CC1(C)CCC[C@]2(C)C[C@H]3COC(=O)[C@H]3[C@]12C |
| InChI | InChI=1S/C15H24O2/c1-13(2)6-5-7-14(3)8-10-9-17-12(16)11(10)15(13,14)4/h10-11H,5-9H2,1-4H3/t10-,11-,14+,15+/m0/s1 |
| InChIKey | BSIDXSIUDCVAHE-UOVKNHIHSA-N |
| XLogP | 3.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |