C21H35NO — CID 12012473
[(5S,6R)-6-butan-2-yl-5-methylcyclohexa-1,3-dien-1-yl]-(2,2,6,6-tetramethylpiperidin-1-yl)methanone (PubChem CID 12012473) has the molecular formula C21H35NO and a molecular weight of 317.52 g/mol. Its IUPAC name is [(5S,6R)-6-butan-2-yl-5-methylcyclohexa-1,3-dien-1-yl]-(2,2,6,6-tetramethylpiperidin-1-yl)methanone.
| Compound Name | [(5S,6R)-6-butan-2-yl-5-methylcyclohexa-1,3-dien-1-yl]-(2,2,6,6-tetramethylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 12012473 |
| Molecular Formula | C21H35NO |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | [(5S,6R)-6-butan-2-yl-5-methylcyclohexa-1,3-dien-1-yl]-(2,2,6,6-tetramethylpiperidin-1-yl)methanone |
| SMILES | CCC(C)[C@H]1C(C(=O)N2C(C)(C)CCCC2(C)C)=CC=C[C@@H]1C |
| InChI | InChI=1S/C21H35NO/c1-8-15(2)18-16(3)11-9-12-17(18)19(23)22-20(4,5)13-10-14-21(22,6)7/h9,11-12,15-16,18H,8,10,13-14H2,1-7H3/t15?,16-,18+/m0/s1 |
| InChIKey | CYJGHVVUPNJHHA-BSRYDQRCSA-N |
| XLogP | 5.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |