C15H22GeO5 — CID 12013178
dimethyl 5-oxo-6-trimethylgermyl-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate (PubChem CID 12013178) has the molecular formula C15H22GeO5 and a molecular weight of 354.95 g/mol. Its IUPAC name is dimethyl 5-oxo-6-trimethylgermyl-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate.
| Compound Name | dimethyl 5-oxo-6-trimethylgermyl-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 12013178 |
| Molecular Formula | C15H22GeO5 |
| Molecular Weight | 354.95 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | dimethyl 5-oxo-6-trimethylgermyl-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC2=C([Ge](C)(C)C)C(=O)CC2C1 |
| InChI | InChI=1S/C15H22GeO5/c1-16(2,3)12-10-8-15(13(18)20-4,14(19)21-5)7-9(10)6-11(12)17/h9H,6-8H2,1-5H3 |
| InChIKey | VODVQRGOTBAVCT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.95 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|