C10H25NO2Si2 — CID 12013274
2,2,5,5-tetramethyl-1,6-dioxa-9-aza-2,5-disilacycloundecane (PubChem CID 12013274) has the molecular formula C10H25NO2Si2 and a molecular weight of 247.49 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-1,6-dioxa-9-aza-2,5-disilacycloundecane.
| Compound Name | 2,2,5,5-tetramethyl-1,6-dioxa-9-aza-2,5-disilacycloundecane |
|---|---|
| PubChem CID | 12013274 |
| Molecular Formula | C10H25NO2Si2 |
| Molecular Weight | 247.49 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 2,2,5,5-tetramethyl-1,6-dioxa-9-aza-2,5-disilacycloundecane |
| SMILES | C[Si]1(C)CC[Si](C)(C)OCCNCCO1 |
| InChI | InChI=1S/C10H25NO2Si2/c1-14(2)9-10-15(3,4)13-8-6-11-5-7-12-14/h11H,5-10H2,1-4H3 |
| InChIKey | OOSNUPCNCKKPRU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.49 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|