About 5-ethylsulfanyl-3H-1,3,4-thiadiazole-2-thione
5-ethylsulfanyl-3H-1,3,4-thiadiazole-2-thione (PubChem CID 1201366) has the molecular formula C4H6N2S3
and a molecular weight of 178.31 g/mol. Its IUPAC name is 5-ethylsulfanyl-3H-1,3,4-thiadiazole-2-thione.
Molecular Properties
| Compound Name | 5-ethylsulfanyl-3H-1,3,4-thiadiazole-2-thione |
| PubChem CID | 1201366 |
| Molecular Formula | C4H6N2S3 |
| Molecular Weight | 178.31 g/mol |
| Exact Mass | 177.97 |
| IUPAC Name | 5-ethylsulfanyl-3H-1,3,4-thiadiazole-2-thione |
| SMILES | CCSc1n[nH]c(=S)s1 |
| InChI | InChI=1S/C4H6N2S3/c1-2-8-4-6-5-3(7)9-4/h2H2,1H3,(H,5,7) |
| InChIKey | JLJYQXMUUKOBBO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-ethylsulfanyl-3H-1,3,4-thiadiazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethylsulfanyl-3H-1,3,4-thiadiazole-2-thione?
The IUPAC name of 5-ethylsulfanyl-3H-1,3,4-thiadiazole-2-thione (CID 1201366) is 5-ethylsulfanyl-3H-1,3,4-thiadiazole-2-thione.
What is the SMILES notation for 5-ethylsulfanyl-3H-1,3,4-thiadiazole-2-thione?
The canonical SMILES for 5-ethylsulfanyl-3H-1,3,4-thiadiazole-2-thione is CCSc1n[nH]c(=S)s1.
What is the InChIKey of 5-ethylsulfanyl-3H-1,3,4-thiadiazole-2-thione?
The InChIKey is JLJYQXMUUKOBBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2S3/c1-2-8-4-6-5-3(7)9-4/h2H2,1H3,(H,5,7).
What are the key properties of 5-ethylsulfanyl-3H-1,3,4-thiadiazole-2-thione?
5-ethylsulfanyl-3H-1,3,4-thiadiazole-2-thione has a molecular weight of 178.31 g/mol, XLogP of 2.31, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylsulfanyl-3H-1,3,4-thiadiazole-2-thione is sourced from PubChem (CID 1201366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).