C16H22O3S — CID 12014030
[(2S,3R,5R)-2,6,6-trimethyl-5-phenylsulfanyloxan-3-yl] acetate (PubChem CID 12014030) has the molecular formula C16H22O3S and a molecular weight of 294.42 g/mol. Its IUPAC name is [(2S,3R,5R)-2,6,6-trimethyl-5-phenylsulfanyloxan-3-yl] acetate.
| Compound Name | [(2S,3R,5R)-2,6,6-trimethyl-5-phenylsulfanyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 12014030 |
| Molecular Formula | C16H22O3S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | [(2S,3R,5R)-2,6,6-trimethyl-5-phenylsulfanyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@H](Sc2ccccc2)C(C)(C)O[C@H]1C |
| InChI | InChI=1S/C16H22O3S/c1-11-14(18-12(2)17)10-15(16(3,4)19-11)20-13-8-6-5-7-9-13/h5-9,11,14-15H,10H2,1-4H3/t11-,14+,15+/m0/s1 |
| InChIKey | DQYQEHYWDPPAGN-NILFDRSVSA-N |
| XLogP | 3.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |