About 5,6-diamino-3-methyl-1H-pyrimidine-2,4-dione
5,6-diamino-3-methyl-1H-pyrimidine-2,4-dione (PubChem CID 1201412) has the molecular formula C5H8N4O2
and a molecular weight of 156.15 g/mol. Its IUPAC name is 5,6-diamino-3-methyl-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5,6-diamino-3-methyl-1H-pyrimidine-2,4-dione |
| PubChem CID | 1201412 |
| Molecular Formula | C5H8N4O2 |
| Molecular Weight | 156.15 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | 5,6-diamino-3-methyl-1H-pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)[nH]c(N)c(N)c1=O |
| InChI | InChI=1S/C5H8N4O2/c1-9-4(10)2(6)3(7)8-5(9)11/h6-7H2,1H3,(H,8,11) |
| InChIKey | KNGVGMVHBVVSCF-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 106.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.15 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5,6-diamino-3-methyl-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-diamino-3-methyl-1H-pyrimidine-2,4-dione?
The IUPAC name of 5,6-diamino-3-methyl-1H-pyrimidine-2,4-dione (CID 1201412) is 5,6-diamino-3-methyl-1H-pyrimidine-2,4-dione.
What is the SMILES notation for 5,6-diamino-3-methyl-1H-pyrimidine-2,4-dione?
The canonical SMILES for 5,6-diamino-3-methyl-1H-pyrimidine-2,4-dione is Cn1c(=O)[nH]c(N)c(N)c1=O.
What is the InChIKey of 5,6-diamino-3-methyl-1H-pyrimidine-2,4-dione?
The InChIKey is KNGVGMVHBVVSCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4O2/c1-9-4(10)2(6)3(7)8-5(9)11/h6-7H2,1H3,(H,8,11).
What are the key properties of 5,6-diamino-3-methyl-1H-pyrimidine-2,4-dione?
5,6-diamino-3-methyl-1H-pyrimidine-2,4-dione has a molecular weight of 156.15 g/mol, XLogP of -1.76, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-diamino-3-methyl-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 1201412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).