C19H21NO2 — CID 12014357
(1S,2S,3S,10R,11R)-3-(4-methylphenyl)-4-oxa-8-azatetracyclo[9.2.1.02,10.03,8]tetradec-12-en-9-one (PubChem CID 12014357) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is (1S,2S,3S,10R,11R)-3-(4-methylphenyl)-4-oxa-8-azatetracyclo[9.2.1.02,10.03,8]tetradec-12-en-9-one.
| Compound Name | (1S,2S,3S,10R,11R)-3-(4-methylphenyl)-4-oxa-8-azatetracyclo[9.2.1.02,10.03,8]tetradec-12-en-9-one |
|---|---|
| PubChem CID | 12014357 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | (1S,2S,3S,10R,11R)-3-(4-methylphenyl)-4-oxa-8-azatetracyclo[9.2.1.02,10.03,8]tetradec-12-en-9-one |
| SMILES | Cc1ccc([C@]23OCCCN2C(=O)[C@H]2[C@@H]3[C@@H]3C=C[C@H]2C3)cc1 |
| InChI | InChI=1S/C19H21NO2/c1-12-3-7-15(8-4-12)19-17-14-6-5-13(11-14)16(17)18(21)20(19)9-2-10-22-19/h3-8,13-14,16-17H,2,9-11H2,1H3/t13-,14+,16+,17-,19+/m0/s1 |
| InChIKey | DFDARCLDTICCFN-XMJRAMJNSA-N |
| XLogP | 2.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|