1,5-dimethyltriazole-4-carboxylic acid

C5H7N3O2 — CID 1201471

IUPAC1,5-dimethyltriazole-4-carboxylic acid
SMILESCc1c(C(=O)O)nnn1C
InChIInChI=1S/C5H7N3O2/c1-3-4(5(9)10)6-7-8(3)2/h1-2H3,(H,9,10)
InChIKeyCTIOCGQJYWNIBA-UHFFFAOYSA-N
MW141.13 g/mol
LogP-0.18
Rot. Bonds1

About 1,5-dimethyltriazole-4-carboxylic acid

1,5-dimethyltriazole-4-carboxylic acid (PubChem CID 1201471) has the molecular formula C5H7N3O2 and a molecular weight of 141.13 g/mol. Its IUPAC name is 1,5-dimethyltriazole-4-carboxylic acid.

Molecular Properties

Compound Name1,5-dimethyltriazole-4-carboxylic acid
PubChem CID1201471
Molecular FormulaC5H7N3O2
Molecular Weight141.13 g/mol
Exact Mass141.05
IUPAC Name1,5-dimethyltriazole-4-carboxylic acid
SMILESCc1c(C(=O)O)nnn1C
InChIInChI=1S/C5H7N3O2/c1-3-4(5(9)10)6-7-8(3)2/h1-2H3,(H,9,10)
InChIKeyCTIOCGQJYWNIBA-UHFFFAOYSA-N
XLogP-0.18
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500141.13
LogP ≤ 5-0.18
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1,5-dimethyltriazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,5-dimethyltriazole-4-carboxylic acid?
The IUPAC name of 1,5-dimethyltriazole-4-carboxylic acid (CID 1201471) is 1,5-dimethyltriazole-4-carboxylic acid.
What is the SMILES notation for 1,5-dimethyltriazole-4-carboxylic acid?
The canonical SMILES for 1,5-dimethyltriazole-4-carboxylic acid is Cc1c(C(=O)O)nnn1C.
What is the InChIKey of 1,5-dimethyltriazole-4-carboxylic acid?
The InChIKey is CTIOCGQJYWNIBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O2/c1-3-4(5(9)10)6-7-8(3)2/h1-2H3,(H,9,10).
What are the key properties of 1,5-dimethyltriazole-4-carboxylic acid?
1,5-dimethyltriazole-4-carboxylic acid has a molecular weight of 141.13 g/mol, XLogP of -0.18, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethyltriazole-4-carboxylic acid is sourced from PubChem (CID 1201471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).