About anthracen-2-ylmethanol
anthracen-2-ylmethanol (PubChem CID 1201478) has the molecular formula C15H12O
and a molecular weight of 208.26 g/mol. Its IUPAC name is anthracen-2-ylmethanol.
Molecular Properties
| Compound Name | anthracen-2-ylmethanol |
| PubChem CID | 1201478 |
| Molecular Formula | C15H12O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | anthracen-2-ylmethanol |
| SMILES | OCc1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C15H12O/c16-10-11-5-6-14-8-12-3-1-2-4-13(12)9-15(14)7-11/h1-9,16H,10H2 |
| InChIKey | ZMUUBYLNJMTHBS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracen-2-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracen-2-ylmethanol?
The IUPAC name of anthracen-2-ylmethanol (CID 1201478) is anthracen-2-ylmethanol.
What is the SMILES notation for anthracen-2-ylmethanol?
The canonical SMILES for anthracen-2-ylmethanol is OCc1ccc2cc3ccccc3cc2c1.
What is the InChIKey of anthracen-2-ylmethanol?
The InChIKey is ZMUUBYLNJMTHBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O/c16-10-11-5-6-14-8-12-3-1-2-4-13(12)9-15(14)7-11/h1-9,16H,10H2.
What are the key properties of anthracen-2-ylmethanol?
anthracen-2-ylmethanol has a molecular weight of 208.26 g/mol, XLogP of 3.49, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for anthracen-2-ylmethanol is sourced from PubChem (CID 1201478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).