C8H8Cl3N3O3 — CID 1201484
N-[(1R)-2,2,2-trichloro-1-(5-methyl-2,4-dioxopyrimidin-1-yl)ethyl]formamide (PubChem CID 1201484) has the molecular formula C8H8Cl3N3O3 and a molecular weight of 300.53 g/mol. Its IUPAC name is N-[(1R)-2,2,2-trichloro-1-(5-methyl-2,4-dioxopyrimidin-1-yl)ethyl]formamide.
| Compound Name | N-[(1R)-2,2,2-trichloro-1-(5-methyl-2,4-dioxopyrimidin-1-yl)ethyl]formamide |
|---|---|
| PubChem CID | 1201484 |
| Molecular Formula | C8H8Cl3N3O3 |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 298.96 |
| IUPAC Name | N-[(1R)-2,2,2-trichloro-1-(5-methyl-2,4-dioxopyrimidin-1-yl)ethyl]formamide |
| SMILES | Cc1cn([C@@H](NC=O)C(Cl)(Cl)Cl)c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H8Cl3N3O3/c1-4-2-14(7(17)13-5(4)16)6(12-3-15)8(9,10)11/h2-3,6H,1H3,(H,12,15)(H,13,16,17)/t6-/m1/s1 |
| InChIKey | PBWUKOLXZFWBLL-ZCFIWIBFSA-N |
| XLogP | 0.46 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|