About [(2S)-2-[(2S,5R)-5-[(2R)-1-acetyloxy-2-hydroxypropan-2-yl]-2-methyloxolan-2-yl]-2-hydroxyethyl] acetate
[(2S)-2-[(2S,5R)-5-[(2R)-1-acetyloxy-2-hydroxypropan-2-yl]-2-methyloxolan-2-yl]-2-hydroxyethyl] acetate (PubChem CID 12014898) has the molecular formula C14H24O7
and a molecular weight of 304.34 g/mol. Its IUPAC name is [(2S)-2-[(2S,5R)-5-[(2R)-1-acetyloxy-2-hydroxypropan-2-yl]-2-methyloxolan-2-yl]-2-hydroxyethyl] acetate.
Molecular Properties
| Compound Name | [(2S)-2-[(2S,5R)-5-[(2R)-1-acetyloxy-2-hydroxypropan-2-yl]-2-methyloxolan-2-yl]-2-hydroxyethyl] acetate |
| PubChem CID | 12014898 |
| Molecular Formula | C14H24O7 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | [(2S)-2-[(2S,5R)-5-[(2R)-1-acetyloxy-2-hydroxypropan-2-yl]-2-methyloxolan-2-yl]-2-hydroxyethyl] acetate |
| SMILES | CC(=O)OC[C@H](O)[C@]1(C)CC[C@H]([C@](C)(O)COC(C)=O)O1 |
| InChI | InChI=1S/C14H24O7/c1-9(15)19-7-11(17)14(4)6-5-12(21-14)13(3,18)8-20-10(2)16/h11-12,17-18H,5-8H2,1-4H3/t11-,12+,13+,14-/m0/s1 |
| InChIKey | GBHILXCXVRFBER-DGAVXFQQSA-N |
| XLogP | 0.16 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [(2S)-2-[(2S,5R)-5-[(2R)-1-acetyloxy-2-hydroxypropan-2-yl]-2-methyloxolan-2-yl]-2-hydroxyethyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-[(2S,5R)-5-[(2R)-1-acetyloxy-2-hydroxypropan-2-yl]-2-methyloxolan-2-yl]-2-hydroxyethyl] acetate?
The IUPAC name of [(2S)-2-[(2S,5R)-5-[(2R)-1-acetyloxy-2-hydroxypropan-2-yl]-2-methyloxolan-2-yl]-2-hydroxyethyl] acetate (CID 12014898) is [(2S)-2-[(2S,5R)-5-[(2R)-1-acetyloxy-2-hydroxypropan-2-yl]-2-methyloxolan-2-yl]-2-hydroxyethyl] acetate.
What is the SMILES notation for [(2S)-2-[(2S,5R)-5-[(2R)-1-acetyloxy-2-hydroxypropan-2-yl]-2-methyloxolan-2-yl]-2-hydroxyethyl] acetate?
The canonical SMILES for [(2S)-2-[(2S,5R)-5-[(2R)-1-acetyloxy-2-hydroxypropan-2-yl]-2-methyloxolan-2-yl]-2-hydroxyethyl] acetate is CC(=O)OC[C@H](O)[C@]1(C)CC[C@H]([C@](C)(O)COC(C)=O)O1.
What is the InChIKey of [(2S)-2-[(2S,5R)-5-[(2R)-1-acetyloxy-2-hydroxypropan-2-yl]-2-methyloxolan-2-yl]-2-hydroxyethyl] acetate?
The InChIKey is GBHILXCXVRFBER-DGAVXFQQSA-N. The full InChI is InChI=1S/C14H24O7/c1-9(15)19-7-11(17)14(4)6-5-12(21-14)13(3,18)8-20-10(2)16/h11-12,17-18H,5-8H2,1-4H3/t11-,12+,13+,14-/m0/s1.
What are the key properties of [(2S)-2-[(2S,5R)-5-[(2R)-1-acetyloxy-2-hydroxypropan-2-yl]-2-methyloxolan-2-yl]-2-hydroxyethyl] acetate?
[(2S)-2-[(2S,5R)-5-[(2R)-1-acetyloxy-2-hydroxypropan-2-yl]-2-methyloxolan-2-yl]-2-hydroxyethyl] acetate has a molecular weight of 304.34 g/mol, XLogP of 0.16, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-[(2S,5R)-5-[(2R)-1-acetyloxy-2-hydroxypropan-2-yl]-2-methyloxolan-2-yl]-2-hydroxyethyl] acetate is sourced from PubChem (CID 12014898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).