About [2-[(2S,5R)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-2-oxoethyl] acetate
[2-[(2S,5R)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-2-oxoethyl] acetate (PubChem CID 12014900) has the molecular formula C12H20O5
and a molecular weight of 244.29 g/mol. Its IUPAC name is [2-[(2S,5R)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-2-oxoethyl] acetate.
Molecular Properties
| Compound Name | [2-[(2S,5R)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-2-oxoethyl] acetate |
| PubChem CID | 12014900 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | [2-[(2S,5R)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)[C@]1(C)CC[C@H](C(C)(C)O)O1 |
| InChI | InChI=1S/C12H20O5/c1-8(13)16-7-9(14)12(4)6-5-10(17-12)11(2,3)15/h10,15H,5-7H2,1-4H3/t10-,12+/m1/s1 |
| InChIKey | PZGIDUXIHYVZRB-PWSUYJOCSA-N |
| XLogP | 0.83 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[(2S,5R)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-2-oxoethyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2S,5R)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-2-oxoethyl] acetate?
The IUPAC name of [2-[(2S,5R)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-2-oxoethyl] acetate (CID 12014900) is [2-[(2S,5R)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-2-oxoethyl] acetate.
What is the SMILES notation for [2-[(2S,5R)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-2-oxoethyl] acetate?
The canonical SMILES for [2-[(2S,5R)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-2-oxoethyl] acetate is CC(=O)OCC(=O)[C@]1(C)CC[C@H](C(C)(C)O)O1.
What is the InChIKey of [2-[(2S,5R)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-2-oxoethyl] acetate?
The InChIKey is PZGIDUXIHYVZRB-PWSUYJOCSA-N. The full InChI is InChI=1S/C12H20O5/c1-8(13)16-7-9(14)12(4)6-5-10(17-12)11(2,3)15/h10,15H,5-7H2,1-4H3/t10-,12+/m1/s1.
What are the key properties of [2-[(2S,5R)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-2-oxoethyl] acetate?
[2-[(2S,5R)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-2-oxoethyl] acetate has a molecular weight of 244.29 g/mol, XLogP of 0.83, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2S,5R)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-2-oxoethyl] acetate is sourced from PubChem (CID 12014900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).