About 1-propan-2-yltriazole
1-propan-2-yltriazole (PubChem CID 12015095) has the molecular formula C5H9N3
and a molecular weight of 111.15 g/mol. Its IUPAC name is 1-propan-2-yltriazole.
Molecular Properties
| Compound Name | 1-propan-2-yltriazole |
| PubChem CID | 12015095 |
| Molecular Formula | C5H9N3 |
| Molecular Weight | 111.15 g/mol |
| Exact Mass | 111.08 |
| IUPAC Name | 1-propan-2-yltriazole |
| SMILES | CC(C)n1ccnn1 |
| InChI | InChI=1S/C5H9N3/c1-5(2)8-4-3-6-7-8/h3-5H,1-2H3 |
| InChIKey | BSGWGQQMKGFUPS-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.15 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-propan-2-yltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-yltriazole?
The IUPAC name of 1-propan-2-yltriazole (CID 12015095) is 1-propan-2-yltriazole.
What is the SMILES notation for 1-propan-2-yltriazole?
The canonical SMILES for 1-propan-2-yltriazole is CC(C)n1ccnn1.
What is the InChIKey of 1-propan-2-yltriazole?
The InChIKey is BSGWGQQMKGFUPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3/c1-5(2)8-4-3-6-7-8/h3-5H,1-2H3.
What are the key properties of 1-propan-2-yltriazole?
1-propan-2-yltriazole has a molecular weight of 111.15 g/mol, XLogP of 0.86, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-yltriazole is sourced from PubChem (CID 12015095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).