About [1,2]oxazolo[5,4-b]pyridin-3-one
[1,2]oxazolo[5,4-b]pyridin-3-one (PubChem CID 1201514) has the molecular formula C6H4N2O2
and a molecular weight of 136.11 g/mol. Its IUPAC name is [1,2]oxazolo[5,4-b]pyridin-3-one.
Molecular Properties
| Compound Name | [1,2]oxazolo[5,4-b]pyridin-3-one |
| PubChem CID | 1201514 |
| Molecular Formula | C6H4N2O2 |
| Molecular Weight | 136.11 g/mol |
| Exact Mass | 136.03 |
| IUPAC Name | [1,2]oxazolo[5,4-b]pyridin-3-one |
| SMILES | O=c1[nH]oc2ncccc12 |
| InChI | InChI=1S/C6H4N2O2/c9-5-4-2-1-3-7-6(4)10-8-5/h1-3H,(H,8,9) |
| InChIKey | VHMSVJIBCHFSKU-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.11 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1,2]oxazolo[5,4-b]pyridin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,2]oxazolo[5,4-b]pyridin-3-one?
The IUPAC name of [1,2]oxazolo[5,4-b]pyridin-3-one (CID 1201514) is [1,2]oxazolo[5,4-b]pyridin-3-one.
What is the SMILES notation for [1,2]oxazolo[5,4-b]pyridin-3-one?
The canonical SMILES for [1,2]oxazolo[5,4-b]pyridin-3-one is O=c1[nH]oc2ncccc12.
What is the InChIKey of [1,2]oxazolo[5,4-b]pyridin-3-one?
The InChIKey is VHMSVJIBCHFSKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O2/c9-5-4-2-1-3-7-6(4)10-8-5/h1-3H,(H,8,9).
What are the key properties of [1,2]oxazolo[5,4-b]pyridin-3-one?
[1,2]oxazolo[5,4-b]pyridin-3-one has a molecular weight of 136.11 g/mol, XLogP of 0.52, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1,2]oxazolo[5,4-b]pyridin-3-one is sourced from PubChem (CID 1201514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).