About (3Z)-3-(2-hydroxy-2,6,6-trimethylcyclohexylidene)propanenitrile
(3Z)-3-(2-hydroxy-2,6,6-trimethylcyclohexylidene)propanenitrile (PubChem CID 12015141) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is (3Z)-3-(2-hydroxy-2,6,6-trimethylcyclohexylidene)propanenitrile.
Molecular Properties
| Compound Name | (3Z)-3-(2-hydroxy-2,6,6-trimethylcyclohexylidene)propanenitrile |
| PubChem CID | 12015141 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (3Z)-3-(2-hydroxy-2,6,6-trimethylcyclohexylidene)propanenitrile |
| SMILES | CC1(C)CCCC(C)(O)/C1=C\CC#N |
| InChI | InChI=1S/C12H19NO/c1-11(2)7-5-8-12(3,14)10(11)6-4-9-13/h6,14H,4-5,7-8H2,1-3H3/b10-6- |
| InChIKey | MBRKZCGOVKMALA-POHAHGRESA-N |
| XLogP | 2.79 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-(2-hydroxy-2,6,6-trimethylcyclohexylidene)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-(2-hydroxy-2,6,6-trimethylcyclohexylidene)propanenitrile?
The IUPAC name of (3Z)-3-(2-hydroxy-2,6,6-trimethylcyclohexylidene)propanenitrile (CID 12015141) is (3Z)-3-(2-hydroxy-2,6,6-trimethylcyclohexylidene)propanenitrile.
What is the SMILES notation for (3Z)-3-(2-hydroxy-2,6,6-trimethylcyclohexylidene)propanenitrile?
The canonical SMILES for (3Z)-3-(2-hydroxy-2,6,6-trimethylcyclohexylidene)propanenitrile is CC1(C)CCCC(C)(O)/C1=C\CC#N.
What is the InChIKey of (3Z)-3-(2-hydroxy-2,6,6-trimethylcyclohexylidene)propanenitrile?
The InChIKey is MBRKZCGOVKMALA-POHAHGRESA-N. The full InChI is InChI=1S/C12H19NO/c1-11(2)7-5-8-12(3,14)10(11)6-4-9-13/h6,14H,4-5,7-8H2,1-3H3/b10-6-.
What are the key properties of (3Z)-3-(2-hydroxy-2,6,6-trimethylcyclohexylidene)propanenitrile?
(3Z)-3-(2-hydroxy-2,6,6-trimethylcyclohexylidene)propanenitrile has a molecular weight of 193.29 g/mol, XLogP of 2.79, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-(2-hydroxy-2,6,6-trimethylcyclohexylidene)propanenitrile is sourced from PubChem (CID 12015141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).