C24H26O12 — CID 12015468
dimethyl 2-[2-[3,4-dimethoxy-2,5-bis(methoxycarbonyl)cyclopenta-2,4-dien-1-ylidene]ethylidene]-4,5-dimethoxycyclopenta-3,5-diene-1,3-dicarboxylate (PubChem CID 12015468) has the molecular formula C24H26O12 and a molecular weight of 506.46 g/mol. Its IUPAC name is dimethyl 2-[2-[3,4-dimethoxy-2,5-bis(methoxycarbonyl)cyclopenta-2,4-dien-1-ylidene]ethylidene]-4,5-dimethoxycyclopenta-3,5-diene-1,3-dicarboxylate.
| Compound Name | dimethyl 2-[2-[3,4-dimethoxy-2,5-bis(methoxycarbonyl)cyclopenta-2,4-dien-1-ylidene]ethylidene]-4,5-dimethoxycyclopenta-3,5-diene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 12015468 |
| Molecular Formula | C24H26O12 |
| Molecular Weight | 506.46 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | dimethyl 2-[2-[3,4-dimethoxy-2,5-bis(methoxycarbonyl)cyclopenta-2,4-dien-1-ylidene]ethylidene]-4,5-dimethoxycyclopenta-3,5-diene-1,3-dicarboxylate |
| SMILES | COC(=O)C1=C(OC)C(OC)=C(C(=O)OC)C1=CC=C1C(C(=O)OC)=C(OC)C(OC)=C1C(=O)OC |
| InChI | InChI=1S/C24H26O12/c1-29-17-13(21(25)33-5)11(14(18(17)30-2)22(26)34-6)9-10-12-15(23(27)35-7)19(31-3)20(32-4)16(12)24(28)36-8/h9-10H,1-8H3 |
| InChIKey | OVCLNSSECRQACG-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.46 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|