C10H10F4S3 — CID 12015587
4-fluoro-7,8-dimethyl-3-(trifluoromethyl)-1,2,10-trithiaspiro[4.5]deca-3,7-diene (PubChem CID 12015587) has the molecular formula C10H10F4S3 and a molecular weight of 302.38 g/mol. Its IUPAC name is 4-fluoro-7,8-dimethyl-3-(trifluoromethyl)-1,2,10-trithiaspiro[4.5]deca-3,7-diene.
| Compound Name | 4-fluoro-7,8-dimethyl-3-(trifluoromethyl)-1,2,10-trithiaspiro[4.5]deca-3,7-diene |
|---|---|
| PubChem CID | 12015587 |
| Molecular Formula | C10H10F4S3 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | 4-fluoro-7,8-dimethyl-3-(trifluoromethyl)-1,2,10-trithiaspiro[4.5]deca-3,7-diene |
| SMILES | CC1=C(C)CC2(SC1)SSC(C(F)(F)F)=C2F |
| InChI | InChI=1S/C10H10F4S3/c1-5-3-9(15-4-6(5)2)7(11)8(16-17-9)10(12,13)14/h3-4H2,1-2H3 |
| InChIKey | CUWFDFBRCFONEL-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|