C11H11F5S3 — CID 12015588
4-fluoro-7,8-dimethyl-3-(1,1,2,2-tetrafluoroethyl)-1,2,10-trithiaspiro[4.5]deca-3,7-diene (PubChem CID 12015588) has the molecular formula C11H11F5S3 and a molecular weight of 334.40 g/mol. Its IUPAC name is 4-fluoro-7,8-dimethyl-3-(1,1,2,2-tetrafluoroethyl)-1,2,10-trithiaspiro[4.5]deca-3,7-diene.
| Compound Name | 4-fluoro-7,8-dimethyl-3-(1,1,2,2-tetrafluoroethyl)-1,2,10-trithiaspiro[4.5]deca-3,7-diene |
|---|---|
| PubChem CID | 12015588 |
| Molecular Formula | C11H11F5S3 |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | 4-fluoro-7,8-dimethyl-3-(1,1,2,2-tetrafluoroethyl)-1,2,10-trithiaspiro[4.5]deca-3,7-diene |
| SMILES | CC1=C(C)CC2(SC1)SSC(C(F)(F)C(F)F)=C2F |
| InChI | InChI=1S/C11H11F5S3/c1-5-3-10(17-4-6(5)2)7(12)8(18-19-10)11(15,16)9(13)14/h9H,3-4H2,1-2H3 |
| InChIKey | FXXZAEPILUEHJS-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|