C21H29F9O4 — CID 12015792
diethyl 2-hept-6-enyl-2-(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)propanedioate (PubChem CID 12015792) has the molecular formula C21H29F9O4 and a molecular weight of 516.44 g/mol. Its IUPAC name is diethyl 2-hept-6-enyl-2-(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)propanedioate.
| Compound Name | diethyl 2-hept-6-enyl-2-(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)propanedioate |
|---|---|
| PubChem CID | 12015792 |
| Molecular Formula | C21H29F9O4 |
| Molecular Weight | 516.44 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | diethyl 2-hept-6-enyl-2-(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)propanedioate |
| SMILES | C=CCCCCCC(CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C21H29F9O4/c1-4-7-8-9-10-12-17(15(31)33-5-2,16(32)34-6-3)13-11-14-18(22,23)19(24,25)20(26,27)21(28,29)30/h4H,1,5-14H2,2-3H3 |
| InChIKey | RLCOFJNZJZNDJO-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.44 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|