C35H38N4O6 — CID 12016154
3-[(2S,3S)-8-ethenyl-13-ethyl-18,20-bis(methoxycarbonyl)-3,7,12,17-tetramethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoic acid (PubChem CID 12016154) has the molecular formula C35H38N4O6 and a molecular weight of 610.71 g/mol. Its IUPAC name is 3-[(2S,3S)-8-ethenyl-13-ethyl-18,20-bis(methoxycarbonyl)-3,7,12,17-tetramethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[(2S,3S)-8-ethenyl-13-ethyl-18,20-bis(methoxycarbonyl)-3,7,12,17-tetramethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 12016154 |
| Molecular Formula | C35H38N4O6 |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.28 |
| IUPAC Name | 3-[(2S,3S)-8-ethenyl-13-ethyl-18,20-bis(methoxycarbonyl)-3,7,12,17-tetramethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoic acid |
| SMILES | C=Cc1c(C)c2cc3nc(c(C(=O)OC)c4nc(cc5[nH]c(cc1[nH]2)c(C)c5CC)C(C)=C4C(=O)OC)[C@@H](CCC(=O)O)[C@@H]3C |
| InChI | InChI=1S/C35H38N4O6/c1-9-20-16(3)23-13-25-18(5)22(11-12-29(40)41)32(38-25)31(35(43)45-8)33-30(34(42)44-7)19(6)26(39-33)15-28-21(10-2)17(4)24(37-28)14-27(20)36-23/h9,13-15,18,22,36-37H,1,10-12H2,2-8H3,(H,40,41)/b23-13-,24-14-,25-13-,26-15-,27-14-,28-15-,32-31+,33-31+/t18-,22-/m0/s1 |
| InChIKey | JTMXYSNWBGZPSZ-MMEOGCCCSA-N |
| XLogP | 6.78 |
| TPSA | 147.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |