C16H19NO — CID 12016303
(1R,13R)-14,14-dimethyl-3-azatetracyclo[11.1.1.02,11.04,9]pentadeca-2(11),3,9-trien-5-one (PubChem CID 12016303) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is (1R,13R)-14,14-dimethyl-3-azatetracyclo[11.1.1.02,11.04,9]pentadeca-2(11),3,9-trien-5-one.
| Compound Name | (1R,13R)-14,14-dimethyl-3-azatetracyclo[11.1.1.02,11.04,9]pentadeca-2(11),3,9-trien-5-one |
|---|---|
| PubChem CID | 12016303 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | (1R,13R)-14,14-dimethyl-3-azatetracyclo[11.1.1.02,11.04,9]pentadeca-2(11),3,9-trien-5-one |
| SMILES | CC1(C)[C@H]2Cc3cc4c(nc3[C@@H]1C2)C(=O)CCC4 |
| InChI | InChI=1S/C16H19NO/c1-16(2)11-7-10-6-9-4-3-5-13(18)15(9)17-14(10)12(16)8-11/h6,11-12H,3-5,7-8H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | JOBLSPKPCROLOC-RYUDHWBXSA-N |
| XLogP | 3.29 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |