C12H17NO2 — CID 12016357
(2R,3R,4R,5R)-1,2-dimethyl-5-phenylpyrrolidine-3,4-diol (PubChem CID 12016357) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is (2R,3R,4R,5R)-1,2-dimethyl-5-phenylpyrrolidine-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-1,2-dimethyl-5-phenylpyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 12016357 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | (2R,3R,4R,5R)-1,2-dimethyl-5-phenylpyrrolidine-3,4-diol |
| SMILES | C[C@@H]1[C@@H](O)[C@H](O)[C@@H](c2ccccc2)N1C |
| InChI | InChI=1S/C12H17NO2/c1-8-11(14)12(15)10(13(8)2)9-6-4-3-5-7-9/h3-8,10-12,14-15H,1-2H3/t8-,10-,11-,12-/m1/s1 |
| InChIKey | BGOPHPXMJQZZQM-HJQYOEGKSA-N |
| XLogP | 0.78 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |