About ethyl (E)-3-[3,5-difluoro-4-(4-sulfamoylphenoxy)phenyl]-2-methylprop-2-enoate
ethyl (E)-3-[3,5-difluoro-4-(4-sulfamoylphenoxy)phenyl]-2-methylprop-2-enoate (PubChem CID 12016767) has the molecular formula C18H17F2NO5S
and a molecular weight of 397.40 g/mol. Its IUPAC name is ethyl (E)-3-[3,5-difluoro-4-(4-sulfamoylphenoxy)phenyl]-2-methylprop-2-enoate.
Molecular Properties
| Compound Name | ethyl (E)-3-[3,5-difluoro-4-(4-sulfamoylphenoxy)phenyl]-2-methylprop-2-enoate |
| PubChem CID | 12016767 |
| Molecular Formula | C18H17F2NO5S |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | ethyl (E)-3-[3,5-difluoro-4-(4-sulfamoylphenoxy)phenyl]-2-methylprop-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/c1cc(F)c(Oc2ccc(S(N)(=O)=O)cc2)c(F)c1 |
| InChI | InChI=1S/C18H17F2NO5S/c1-3-25-18(22)11(2)8-12-9-15(19)17(16(20)10-12)26-13-4-6-14(7-5-13)27(21,23)24/h4-10H,3H2,1-2H3,(H2,21,23,24)/b11-8+ |
| InChIKey | QXQBECSTABNULW-DHZHZOJOSA-N |
| XLogP | 3.37 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-3-[3,5-difluoro-4-(4-sulfamoylphenoxy)phenyl]-2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-3-[3,5-difluoro-4-(4-sulfamoylphenoxy)phenyl]-2-methylprop-2-enoate?
The IUPAC name of ethyl (E)-3-[3,5-difluoro-4-(4-sulfamoylphenoxy)phenyl]-2-methylprop-2-enoate (CID 12016767) is ethyl (E)-3-[3,5-difluoro-4-(4-sulfamoylphenoxy)phenyl]-2-methylprop-2-enoate.
What is the SMILES notation for ethyl (E)-3-[3,5-difluoro-4-(4-sulfamoylphenoxy)phenyl]-2-methylprop-2-enoate?
The canonical SMILES for ethyl (E)-3-[3,5-difluoro-4-(4-sulfamoylphenoxy)phenyl]-2-methylprop-2-enoate is CCOC(=O)/C(C)=C/c1cc(F)c(Oc2ccc(S(N)(=O)=O)cc2)c(F)c1.
What is the InChIKey of ethyl (E)-3-[3,5-difluoro-4-(4-sulfamoylphenoxy)phenyl]-2-methylprop-2-enoate?
The InChIKey is QXQBECSTABNULW-DHZHZOJOSA-N. The full InChI is InChI=1S/C18H17F2NO5S/c1-3-25-18(22)11(2)8-12-9-15(19)17(16(20)10-12)26-13-4-6-14(7-5-13)27(21,23)24/h4-10H,3H2,1-2H3,(H2,21,23,24)/b11-8+.
What are the key properties of ethyl (E)-3-[3,5-difluoro-4-(4-sulfamoylphenoxy)phenyl]-2-methylprop-2-enoate?
ethyl (E)-3-[3,5-difluoro-4-(4-sulfamoylphenoxy)phenyl]-2-methylprop-2-enoate has a molecular weight of 397.40 g/mol, XLogP of 3.37, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-3-[3,5-difluoro-4-(4-sulfamoylphenoxy)phenyl]-2-methylprop-2-enoate is sourced from PubChem (CID 12016767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).